C20H30N4O3 — CID 142419026
(2S)-2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-1-yl]propanoic acid (PubChem CID 142419026) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is (2S)-2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-1-yl]propanoic acid.
| Compound Name | (2S)-2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 142419026 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (2S)-2-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propylcarbamoyl]piperidin-1-yl]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N1CCC(C(=O)NCCCc2ccc3c(n2)NCCC3)CC1 |
| InChI | InChI=1S/C20H30N4O3/c1-14(20(26)27)24-12-8-16(9-13-24)19(25)22-11-3-5-17-7-6-15-4-2-10-21-18(15)23-17/h6-7,14,16H,2-5,8-13H2,1H3,(H,21,23)(H,22,25)(H,26,27)/t14-/m0/s1 |
| InChIKey | KKZQUGAUNJQDEK-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|