C22H31N5O — CID 166289019
trans-(1R,2R)-2-[2-(2-methylpropyl)pyrazol-3-yl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 166289019) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-(2-methylpropyl)pyrazol-3-yl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-[2-(2-methylpropyl)pyrazol-3-yl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166289019 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | trans-(1R,2R)-2-[2-(2-methylpropyl)pyrazol-3-yl]-N-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | CC(C)Cn1nccc1[C@@H]1C[C@H]1C(=O)NCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C22H31N5O/c1-15(2)14-27-20(9-12-25-27)18-13-19(18)22(28)24-11-4-6-17-8-7-16-5-3-10-23-21(16)26-17/h7-9,12,15,18-19H,3-6,10-11,13-14H2,1-2H3,(H,23,26)(H,24,28)/t18-,19-/m1/s1 |
| InChIKey | JCWFZVFMHDKMJH-RTBURBONSA-N |
| XLogP | 3.14 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|