C25H32FN3O2 — CID 135312472
2-[3-fluoro-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid (PubChem CID 135312472) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[3-fluoro-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid.
| Compound Name | 2-[3-fluoro-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 135312472 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 2-[3-fluoro-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1CCC(F)(CCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C25H32FN3O2/c26-25(15-17-29(18-25)22(24(30)31)19-8-3-1-4-9-19)14-6-2-5-11-21-13-12-20-10-7-16-27-23(20)28-21/h1,3-4,8-9,12-13,22H,2,5-7,10-11,14-18H2,(H,27,28)(H,30,31) |
| InChIKey | MDAPFIZOTGPBAX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|