C24H28F3N3O2 — CID 139450748
3-(3,4-difluorophenyl)-3-[3-fluoro-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]azetidin-1-yl]propanoic acid (PubChem CID 139450748) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-3-[3-fluoro-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]azetidin-1-yl]propanoic acid.
| Compound Name | 3-(3,4-difluorophenyl)-3-[3-fluoro-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]azetidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 139450748 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 3-(3,4-difluorophenyl)-3-[3-fluoro-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]azetidin-1-yl]propanoic acid |
| SMILES | O=C(O)CC(c1ccc(F)c(F)c1)N1CC(F)(CCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C24H28F3N3O2/c25-19-9-7-17(12-20(19)26)21(13-22(31)32)30-14-24(27,15-30)10-2-1-5-18-8-6-16-4-3-11-28-23(16)29-18/h6-9,12,21H,1-5,10-11,13-15H2,(H,28,29)(H,31,32) |
| InChIKey | JAFDHEOIBNBRCA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|