C25H28FN3O3S — CID 134501512
(3R)-3-(3-fluoro-4-methoxyphenyl)-3-[5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid (PubChem CID 134501512) has the molecular formula C25H28FN3O3S and a molecular weight of 469.58 g/mol. Its IUPAC name is (3R)-3-(3-fluoro-4-methoxyphenyl)-3-[5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid.
| Compound Name | (3R)-3-(3-fluoro-4-methoxyphenyl)-3-[5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134501512 |
| Molecular Formula | C25H28FN3O3S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (3R)-3-(3-fluoro-4-methoxyphenyl)-3-[5-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid |
| SMILES | COc1ccc([C@@H](CC(=O)O)c2ncc(CCCCc3ccc4c(n3)NCCC4)s2)cc1F |
| InChI | InChI=1S/C25H28FN3O3S/c1-32-22-11-9-17(13-21(22)26)20(14-23(30)31)25-28-15-19(33-25)7-3-2-6-18-10-8-16-5-4-12-27-24(16)29-18/h8-11,13,15,20H,2-7,12,14H2,1H3,(H,27,29)(H,30,31)/t20-/m1/s1 |
| InChIKey | QBJMTHBYMINSGJ-HXUWFJFHSA-N |
| XLogP | 5.22 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|