C25H31N5O2S — CID 134499392
(3R)-3-[6-(dimethylamino)-3-pyridinyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid (PubChem CID 134499392) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is (3R)-3-[6-(dimethylamino)-3-pyridinyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid.
| Compound Name | (3R)-3-[6-(dimethylamino)-3-pyridinyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134499392 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (3R)-3-[6-(dimethylamino)-3-pyridinyl]-3-[4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]-1,3-thiazol-2-yl]propanoic acid |
| SMILES | CN(C)c1ccc([C@@H](CC(=O)O)c2nc(CCCCc3ccc4c(n3)NCCC4)cs2)cn1 |
| InChI | InChI=1S/C25H31N5O2S/c1-30(2)22-12-10-18(15-27-22)21(14-23(31)32)25-29-20(16-33-25)8-4-3-7-19-11-9-17-6-5-13-26-24(17)28-19/h9-12,15-16,21H,3-8,13-14H2,1-2H3,(H,26,28)(H,31,32)/t21-/m1/s1 |
| InChIKey | BADLBAKVUVGUCQ-OAQYLSRUSA-N |
| XLogP | 4.53 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|