C25H27N3O4S — CID 10226804
3-(1,3-benzodioxol-5-yl)-4-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]butanoic acid (PubChem CID 10226804) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]butanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 10226804 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-2-yl]butanoic acid |
| SMILES | O=C(O)CC(Cc1nc(CCCc2ccc3c(n2)NCCC3)cs1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H27N3O4S/c29-24(30)13-18(17-7-9-21-22(11-17)32-15-31-21)12-23-27-20(14-33-23)5-1-4-19-8-6-16-3-2-10-26-25(16)28-19/h6-9,11,14,18H,1-5,10,12-13,15H2,(H,26,28)(H,29,30) |
| InChIKey | TVOKBYBZLJJEHI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |