C28H32N4O7 — CID 67560790
(3S)-3-(1,3-benzodioxol-5-yl)-4-[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid (PubChem CID 67560790) has the molecular formula C28H32N4O7 and a molecular weight of 536.59 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yl)-4-[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yl)-4-[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 67560790 |
| Molecular Formula | C28H32N4O7 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yl)-4-[1-[(4-methyl-1,3-dioxetan-2-yl)methyl]-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid |
| SMILES | CC1OC(Cn2nc(C[C@@H](CC(=O)O)c3ccc4c(c3)OCO4)cc2OCCc2ccc3c(n2)NCCC3)O1 |
| InChI | InChI=1S/C28H32N4O7/c1-17-38-27(39-17)15-32-25(35-10-8-21-6-4-18-3-2-9-29-28(18)30-21)14-22(31-32)11-20(13-26(33)34)19-5-7-23-24(12-19)37-16-36-23/h4-7,12,14,17,20,27H,2-3,8-11,13,15-16H2,1H3,(H,29,30)(H,33,34)/t17?,20-,27?/m0/s1 |
| InChIKey | IJQYGDCQZNRMSK-RRJGOMNWSA-N |
| XLogP | 3.51 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |