C30H38N4O5 — CID 153388735
3-(5-tert-butyl-2,3-dihydro-1,4-benzodioxin-7-yl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid (PubChem CID 153388735) has the molecular formula C30H38N4O5 and a molecular weight of 534.66 g/mol. Its IUPAC name is 3-(5-tert-butyl-2,3-dihydro-1,4-benzodioxin-7-yl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid.
| Compound Name | 3-(5-tert-butyl-2,3-dihydro-1,4-benzodioxin-7-yl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 153388735 |
| Molecular Formula | C30H38N4O5 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 3-(5-tert-butyl-2,3-dihydro-1,4-benzodioxin-7-yl)-4-[1-methyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]pyrazol-3-yl]butanoic acid |
| SMILES | Cn1nc(CC(CC(=O)O)c2cc3c(c(C(C)(C)C)c2)OCCO3)cc1OCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C30H38N4O5/c1-30(2,3)24-15-21(16-25-28(24)39-13-12-37-25)20(17-27(35)36)14-23-18-26(34(4)33-23)38-11-9-22-8-7-19-6-5-10-31-29(19)32-22/h7-8,15-16,18,20H,5-6,9-14,17H2,1-4H3,(H,31,32)(H,35,36) |
| InChIKey | GXJZHFCOYDJVDL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |