C30H40N4O5 — CID 153388705
(3S)-3-(7-tert-butyl-1,3-benzodioxol-5-yl)-4-[1,5-dimethyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-4H-pyrazol-3-yl]butanoic acid (PubChem CID 153388705) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is (3S)-3-(7-tert-butyl-1,3-benzodioxol-5-yl)-4-[1,5-dimethyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-4H-pyrazol-3-yl]butanoic acid.
| Compound Name | (3S)-3-(7-tert-butyl-1,3-benzodioxol-5-yl)-4-[1,5-dimethyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-4H-pyrazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 153388705 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | (3S)-3-(7-tert-butyl-1,3-benzodioxol-5-yl)-4-[1,5-dimethyl-5-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy]-4H-pyrazol-3-yl]butanoic acid |
| SMILES | CN1N=C(C[C@@H](CC(=O)O)c2cc3c(c(C(C)(C)C)c2)OCO3)CC1(C)OCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C30H40N4O5/c1-29(2,3)24-14-21(15-25-27(24)38-18-37-25)20(16-26(35)36)13-23-17-30(4,34(5)33-23)39-12-10-22-9-8-19-7-6-11-31-28(19)32-22/h8-9,14-15,20H,6-7,10-13,16-18H2,1-5H3,(H,31,32)(H,35,36)/t20-,30?/m0/s1 |
| InChIKey | UAVDSFYGIIDOPL-JGZNSJETSA-N |
| XLogP | 5.08 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |