C24H28N4O5 — CID 142918074
3-(1,3-benzodioxol-5-yl)-4-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 142918074) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]butanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 142918074 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-[5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-2,3-dihydro-1,3,4-oxadiazol-2-yl]butanoic acid |
| SMILES | O=C(O)CC(CC1NN=C(CCCc2ccc3c(n2)NCCC3)O1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H28N4O5/c29-23(30)13-17(16-7-9-19-20(11-16)32-14-31-19)12-22-28-27-21(33-22)5-1-4-18-8-6-15-3-2-10-25-24(15)26-18/h6-9,11,17,22,28H,1-5,10,12-14H2,(H,25,26)(H,29,30) |
| InChIKey | MOQDTKZVGFFQAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |