C23H26N4O3S — CID 10252594
(3S)-3-(6-oxo-1H-pyridin-3-yl)-4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid (PubChem CID 10252594) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is (3S)-3-(6-oxo-1H-pyridin-3-yl)-4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | (3S)-3-(6-oxo-1H-pyridin-3-yl)-4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 10252594 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (3S)-3-(6-oxo-1H-pyridin-3-yl)-4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)C[C@H](Cc1csc(CCCc2ccc3c(n2)NCCC3)n1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C23H26N4O3S/c28-20-9-7-16(13-25-20)17(12-22(29)30)11-19-14-31-21(26-19)5-1-4-18-8-6-15-3-2-10-24-23(15)27-18/h6-9,13-14,17H,1-5,10-12H2,(H,24,27)(H,25,28)(H,29,30)/t17-/m0/s1 |
| InChIKey | TXLQJCZROLFKSQ-KRWDZBQOSA-N |
| XLogP | 3.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |