C23H28N4O3S — CID 142916378
1H-pyridin-2-one;4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid (PubChem CID 142916378) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1H-pyridin-2-one;4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 1H-pyridin-2-one;4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 142916378 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1H-pyridin-2-one;4-[2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(CCCc2ccc3c(n2)NCCC3)n1.O=c1cccc[nH]1 |
| InChI | InChI=1S/C18H23N3O2S.C5H5NO/c22-17(23)8-2-6-15-12-24-16(20-15)7-1-5-14-10-9-13-4-3-11-19-18(13)21-14;7-5-3-1-2-4-6-5/h9-10,12H,1-8,11H2,(H,19,21)(H,22,23);1-4H,(H,6,7) |
| InChIKey | YADKVXNDJLVOTI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |