C26H31F6N3O7 — CID 87989833
3-(6-oxo-1H-pyridin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87989833) has the molecular formula C26H31F6N3O7 and a molecular weight of 611.54 g/mol. Its IUPAC name is 3-(6-oxo-1H-pyridin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-(6-oxo-1H-pyridin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87989833 |
| Molecular Formula | C26H31F6N3O7 |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 3-(6-oxo-1H-pyridin-3-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)CC(CCCCCCc1ccc2c(n1)NCCC2)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C22H29N3O3.2C2HF3O2/c26-20-12-10-18(15-24-20)17(14-21(27)28)6-3-1-2-4-8-19-11-9-16-7-5-13-23-22(16)25-19;2*3-2(4,5)1(6)7/h9-12,15,17H,1-8,13-14H2,(H,23,25)(H,24,26)(H,27,28);2*(H,6,7) |
| InChIKey | ZROVTZQITXYNSC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 169.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|