C23H30F2N4O3 — CID 69370619
3-(2-ethoxypyrimidin-5-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 69370619) has the molecular formula C23H30F2N4O3 and a molecular weight of 448.51 g/mol. Its IUPAC name is 3-(2-ethoxypyrimidin-5-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 3-(2-ethoxypyrimidin-5-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 69370619 |
| Molecular Formula | C23H30F2N4O3 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 3-(2-ethoxypyrimidin-5-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | CCOc1ncc(C(CC(=O)O)CC(F)(F)CCCCc2ccc3c(n2)NCCC3)cn1 |
| InChI | InChI=1S/C23H30F2N4O3/c1-2-32-22-27-14-18(15-28-22)17(12-20(30)31)13-23(24,25)10-4-3-7-19-9-8-16-6-5-11-26-21(16)29-19/h8-9,14-15,17H,2-7,10-13H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | XHWWIPBJNKXZGB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|