C22H28F2N4O2 — CID 69369540
5,5-difluoro-3-(5-methylpyrazin-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 69369540) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 5,5-difluoro-3-(5-methylpyrazin-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 5,5-difluoro-3-(5-methylpyrazin-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 69369540 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 5,5-difluoro-3-(5-methylpyrazin-2-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | Cc1cnc(C(CC(=O)O)CC(F)(F)CCCCc2ccc3c(n2)NCCC3)cn1 |
| InChI | InChI=1S/C22H28F2N4O2/c1-15-13-27-19(14-26-15)17(11-20(29)30)12-22(23,24)9-3-2-6-18-8-7-16-5-4-10-25-21(16)28-18/h7-8,13-14,17H,2-6,9-12H2,1H3,(H,25,28)(H,29,30) |
| InChIKey | UQXINDPAJDBTDU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|