C22H28N4O4 — CID 18475429
3-(6-methoxypyridazin-3-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 18475429) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-(6-methoxypyridazin-3-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 3-(6-methoxypyridazin-3-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 18475429 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-(6-methoxypyridazin-3-yl)-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)CC(=O)CCCCc2ccc3c(n2)NCCC3)nn1 |
| InChI | InChI=1S/C22H28N4O4/c1-30-20-11-10-19(25-26-20)16(14-21(28)29)13-18(27)7-3-2-6-17-9-8-15-5-4-12-23-22(15)24-17/h8-11,16H,2-7,12-14H2,1H3,(H,23,24)(H,28,29) |
| InChIKey | FIJQSMQSNSSYTC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|