C24H26ClF3N2O3 — CID 122499720
3-[4-chloro-3-(trifluoromethyl)phenyl]-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 122499720) has the molecular formula C24H26ClF3N2O3 and a molecular weight of 482.93 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 122499720 |
| Molecular Formula | C24H26ClF3N2O3 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-oxo-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(O)CC(CC(=O)CCCCc1ccc2c(n1)NCCC2)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26ClF3N2O3/c25-21-10-8-16(13-20(21)24(26,27)28)17(14-22(32)33)12-19(31)6-2-1-5-18-9-7-15-4-3-11-29-23(15)30-18/h7-10,13,17H,1-6,11-12,14H2,(H,29,30)(H,32,33) |
| InChIKey | LEMZSMSMWALRRE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|