C25H30N2O2 — CID 22082680
7-(1-benzofuran-6-yl)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonan-5-one (PubChem CID 22082680) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 7-(1-benzofuran-6-yl)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonan-5-one.
| Compound Name | 7-(1-benzofuran-6-yl)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonan-5-one |
|---|---|
| PubChem CID | 22082680 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 7-(1-benzofuran-6-yl)-1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonan-5-one |
| SMILES | CCC(CC(=O)CCCCc1ccc2c(n1)NCCC2)c1ccc2ccoc2c1 |
| InChI | InChI=1S/C25H30N2O2/c1-2-18(21-10-9-19-13-15-29-24(19)17-21)16-23(28)8-4-3-7-22-12-11-20-6-5-14-26-25(20)27-22/h9-13,15,17-18H,2-8,14,16H2,1H3,(H,26,27) |
| InChIKey | OFXXCLUKBCRIAV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|