C13H19N2O4P — CID 23435554
[6-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-6-yl)-2-oxohexyl]phosphonic acid (PubChem CID 23435554) has the molecular formula C13H19N2O4P and a molecular weight of 298.28 g/mol. Its IUPAC name is [6-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-6-yl)-2-oxohexyl]phosphonic acid.
| Compound Name | [6-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-6-yl)-2-oxohexyl]phosphonic acid |
|---|---|
| PubChem CID | 23435554 |
| Molecular Formula | C13H19N2O4P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [6-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-6-yl)-2-oxohexyl]phosphonic acid |
| SMILES | O=C(CCCCc1ccc2c(n1)NCC2)CP(=O)(O)O |
| InChI | InChI=1S/C13H19N2O4P/c16-12(9-20(17,18)19)4-2-1-3-11-6-5-10-7-8-14-13(10)15-11/h5-6H,1-4,7-9H2,(H,14,15)(H2,17,18,19) |
| InChIKey | HYDVGIDLRDOCQO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|