C26H31N3O3 — CID 54089681
ethyl 3-furo[2,3-b]pyridin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate (PubChem CID 54089681) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl 3-furo[2,3-b]pyridin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate.
| Compound Name | ethyl 3-furo[2,3-b]pyridin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate |
|---|---|
| PubChem CID | 54089681 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | ethyl 3-furo[2,3-b]pyridin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate |
| SMILES | CCOC(=O)CC(C=CCCCCc1ccc2c(n1)NCCC2)c1cnc2occc2c1 |
| InChI | InChI=1S/C26H31N3O3/c1-2-31-24(30)17-20(22-16-21-13-15-32-26(21)28-18-22)8-5-3-4-6-10-23-12-11-19-9-7-14-27-25(19)29-23/h5,8,11-13,15-16,18,20H,2-4,6-7,9-10,14,17H2,1H3,(H,27,29) |
| InChIKey | MSYWDHLNKKJNNY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|