C26H36N4O2 — CID 11224366
ethyl (E,3R)-3-(2-propan-2-ylpyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate (PubChem CID 11224366) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is ethyl (E,3R)-3-(2-propan-2-ylpyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate.
| Compound Name | ethyl (E,3R)-3-(2-propan-2-ylpyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate |
|---|---|
| PubChem CID | 11224366 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | ethyl (E,3R)-3-(2-propan-2-ylpyrimidin-5-yl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate |
| SMILES | CCOC(=O)C[C@H](/C=C/CCCCc1ccc2c(n1)NCCC2)c1cnc(C(C)C)nc1 |
| InChI | InChI=1S/C26H36N4O2/c1-4-32-24(31)16-21(22-17-28-25(19(2)3)29-18-22)10-7-5-6-8-12-23-14-13-20-11-9-15-27-26(20)30-23/h7,10,13-14,17-19,21H,4-6,8-9,11-12,15-16H2,1-3H3,(H,27,30)/b10-7+/t21-/m0/s1 |
| InChIKey | NAKHTWOWDVDHCR-CLNPQZTCSA-N |
| XLogP | 5.36 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|