C31H35FN2O3 — CID 154643167
methyl (E,3R)-3-(3-fluoro-4-phenylmethoxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate (PubChem CID 154643167) has the molecular formula C31H35FN2O3 and a molecular weight of 502.63 g/mol. Its IUPAC name is methyl (E,3R)-3-(3-fluoro-4-phenylmethoxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate.
| Compound Name | methyl (E,3R)-3-(3-fluoro-4-phenylmethoxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate |
|---|---|
| PubChem CID | 154643167 |
| Molecular Formula | C31H35FN2O3 |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | methyl (E,3R)-3-(3-fluoro-4-phenylmethoxyphenyl)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate |
| SMILES | COC(=O)C[C@H](/C=C/CCCCc1ccc2c(n1)NCCC2)c1ccc(OCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C31H35FN2O3/c1-36-30(35)21-25(26-16-18-29(28(32)20-26)37-22-23-10-5-4-6-11-23)12-7-2-3-8-14-27-17-15-24-13-9-19-33-31(24)34-27/h4-7,10-12,15-18,20,25H,2-3,8-9,13-14,19,21-22H2,1H3,(H,33,34)/b12-7+/t25-/m0/s1 |
| InChIKey | FQERQVPQBZIUFV-FRHHVXPKSA-N |
| XLogP | 6.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|