C22H30N4O2 — CID 142277672
methyl (E)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate;pyrimidine (PubChem CID 142277672) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is methyl (E)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate;pyrimidine.
| Compound Name | methyl (E)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate;pyrimidine |
|---|---|
| PubChem CID | 142277672 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | methyl (E)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)non-4-enoate;pyrimidine |
| SMILES | COC(=O)CC/C=C/CCCCc1ccc2c(n1)NCCC2.c1cncnc1 |
| InChI | InChI=1S/C18H26N2O2.C4H4N2/c1-22-17(21)11-7-5-3-2-4-6-10-16-13-12-15-9-8-14-19-18(15)20-16;1-2-5-4-6-3-1/h3,5,12-13H,2,4,6-11,14H2,1H3,(H,19,20);1-4H/b5-3+; |
| InChIKey | CLDVQBKFXYJQEJ-WGCWOXMQSA-N |
| XLogP | 4.14 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|