C19H24N4 — CID 142134028
7-[(E)-7-pyrimidin-5-ylhept-6-enyl]-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 142134028) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is 7-[(E)-7-pyrimidin-5-ylhept-6-enyl]-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-[(E)-7-pyrimidin-5-ylhept-6-enyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 142134028 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 7-[(E)-7-pyrimidin-5-ylhept-6-enyl]-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | C(=C/c1cncnc1)\CCCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C19H24N4/c1(2-4-7-16-13-20-15-21-14-16)3-5-9-18-11-10-17-8-6-12-22-19(17)23-18/h4,7,10-11,13-15H,1-3,5-6,8-9,12H2,(H,22,23)/b7-4+ |
| InChIKey | YEWFHDXPHFHNDD-QPJJXVBHSA-N |
| XLogP | 4.05 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|