C13H17ClN2 — CID 141108587
7-(5-chloropent-1-enyl)-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 141108587) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 7-(5-chloropent-1-enyl)-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-(5-chloropent-1-enyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 141108587 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 7-(5-chloropent-1-enyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | ClCCCC=Cc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C13H17ClN2/c14-9-3-1-2-6-12-8-7-11-5-4-10-15-13(11)16-12/h2,6-8H,1,3-5,9-10H2,(H,15,16) |
| InChIKey | CUFXLIQYGZDTSI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|