C15H21N3 — CID 142348115
(Z)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-2-en-4-imine (PubChem CID 142348115) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (Z)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-2-en-4-imine.
| Compound Name | (Z)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-2-en-4-imine |
|---|---|
| PubChem CID | 142348115 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (Z)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-2-en-4-imine |
| SMILES | [H]/N=C(\C=C/C)CCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C15H21N3/c1-2-5-13(16)7-3-8-14-10-9-12-6-4-11-17-15(12)18-14/h2,5,9-10,16H,3-4,6-8,11H2,1H3,(H,17,18)/b5-2-,16-13+ |
| InChIKey | QVDKLRQSICMUML-DTFKNTDISA-N |
| XLogP | 3.36 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|