C23H30N5O3+ — CID 152844416
[2-carboxy-1-(6-methoxy-3-pyridinyl)ethyl]-[3-imino-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hex-1-enyl]azanium (PubChem CID 152844416) has the molecular formula C23H30N5O3+ and a molecular weight of 424.53 g/mol. Its IUPAC name is [2-carboxy-1-(6-methoxy-3-pyridinyl)ethyl]-[3-imino-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hex-1-enyl]azanium.
| Compound Name | [2-carboxy-1-(6-methoxy-3-pyridinyl)ethyl]-[3-imino-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hex-1-enyl]azanium |
|---|---|
| PubChem CID | 152844416 |
| Molecular Formula | C23H30N5O3+ |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [2-carboxy-1-(6-methoxy-3-pyridinyl)ethyl]-[3-imino-6-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hex-1-enyl]azanium |
| SMILES | [H]/N=C(\C=C[NH2+]C(CC(=O)O)c1ccc(OC)nc1)CCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C23H29N5O3/c1-31-21-10-8-17(15-27-21)20(14-22(29)30)25-13-11-18(24)5-2-6-19-9-7-16-4-3-12-26-23(16)28-19/h7-11,13,15,20,24-25H,2-6,12,14H2,1H3,(H,26,28)(H,29,30)/p+1/b13-11?,24-18- |
| InChIKey | SZXMTIIDRFOFJQ-KQOPAAJHSA-O |
| XLogP | 2.48 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|