C22H30N4O — CID 11485411
(E,3R)-1-(2-propan-2-ylpyrimidin-5-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol (PubChem CID 11485411) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (E,3R)-1-(2-propan-2-ylpyrimidin-5-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol.
| Compound Name | (E,3R)-1-(2-propan-2-ylpyrimidin-5-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol |
|---|---|
| PubChem CID | 11485411 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (E,3R)-1-(2-propan-2-ylpyrimidin-5-yl)-7-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)hept-1-en-3-ol |
| SMILES | CC(C)c1ncc(/C=C/[C@H](O)CCCCc2ccc3c(n2)NCCC3)cn1 |
| InChI | InChI=1S/C22H30N4O/c1-16(2)21-24-14-17(15-25-21)9-12-20(27)8-4-3-7-19-11-10-18-6-5-13-23-22(18)26-19/h9-12,14-16,20,27H,3-8,13H2,1-2H3,(H,23,26)/b12-9+/t20-/m1/s1 |
| InChIKey | KIRUPFUXUBNTJZ-RGFVMQALSA-N |
| XLogP | 4.14 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|