About 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen
7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen (PubChem CID 176962671) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen.
Analyze 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen?
The IUPAC name of 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen (CID 176962671) is 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen.
What is the SMILES notation for 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen?
The canonical SMILES for 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen is CCc1ccc2c(n1)NCCC2.[H][H].
What is the InChIKey of 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen?
The InChIKey is BXQRSRULYQFRDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.H2/c1-2-9-6-5-8-4-3-7-11-10(8)12-9;/h5-6H,2-4,7H2,1H3,(H,11,12);1H.
What are the key properties of 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen?
7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen has a molecular weight of 164.25 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1,2,3,4-tetrahydro-1,8-naphthyridine;molecular hydrogen is sourced from PubChem (CID 176962671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).