C14H22N2 — CID 177029071
7-(2-ethylbutyl)-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 177029071) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 7-(2-ethylbutyl)-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 7-(2-ethylbutyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 177029071 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 7-(2-ethylbutyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | CCC(CC)Cc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C14H22N2/c1-3-11(4-2)10-13-8-7-12-6-5-9-15-14(12)16-13/h7-8,11H,3-6,9-10H2,1-2H3,(H,15,16) |
| InChIKey | ZVTQDRIRQIFDPL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |