(2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid

C12H16N2O2 — CID 124639157

IUPAC(2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid
SMILESCC[C@@H](C(=O)O)c1ccc2c(n1)NCCC2
InChIInChI=1S/C12H16N2O2/c1-2-9(12(15)16)10-6-5-8-4-3-7-13-11(8)14-10/h5-6,9H,2-4,7H2,1H3,(H,13,14)(H,15,16)/t9-/m1/s1
InChIKeyVXLHEPBUIAWTHY-SECBINFHSA-N
MW220.27 g/mol
LogP2.02
Rot. Bonds3

About (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid

(2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid (PubChem CID 124639157) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid.

Molecular Properties

Compound Name(2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid
PubChem CID124639157
Molecular FormulaC12H16N2O2
Molecular Weight220.27 g/mol
Exact Mass220.12
IUPAC Name(2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid
SMILESCC[C@@H](C(=O)O)c1ccc2c(n1)NCCC2
InChIInChI=1S/C12H16N2O2/c1-2-9(12(15)16)10-6-5-8-4-3-7-13-11(8)14-10/h5-6,9H,2-4,7H2,1H3,(H,13,14)(H,15,16)/t9-/m1/s1
InChIKeyVXLHEPBUIAWTHY-SECBINFHSA-N
XLogP2.02
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.27
LogP ≤ 52.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid?
The IUPAC name of (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid (CID 124639157) is (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid.
What is the SMILES notation for (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid?
The canonical SMILES for (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid is CC[C@@H](C(=O)O)c1ccc2c(n1)NCCC2.
What is the InChIKey of (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid?
The InChIKey is VXLHEPBUIAWTHY-SECBINFHSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-2-9(12(15)16)10-6-5-8-4-3-7-13-11(8)14-10/h5-6,9H,2-4,7H2,1H3,(H,13,14)(H,15,16)/t9-/m1/s1.
What are the key properties of (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid?
(2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid has a molecular weight of 220.27 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoic acid is sourced from PubChem (CID 124639157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).