C22H38N4O5 — CID 175081539
acetic acid;2-amino-4-[[6-methoxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]amino]butanoic acid (PubChem CID 175081539) has the molecular formula C22H38N4O5 and a molecular weight of 438.57 g/mol. Its IUPAC name is acetic acid;2-amino-4-[[6-methoxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]amino]butanoic acid.
| Compound Name | acetic acid;2-amino-4-[[6-methoxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175081539 |
| Molecular Formula | C22H38N4O5 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | acetic acid;2-amino-4-[[6-methoxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)heptyl]amino]butanoic acid |
| SMILES | CC(=O)O.COC(C)CC(CCCNCCC(N)C(=O)O)c1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C20H34N4O3.C2H4O2/c1-14(27-2)13-16(6-3-10-22-12-9-17(21)20(25)26)18-8-7-15-5-4-11-23-19(15)24-18;1-2(3)4/h7-8,14,16-17,22H,3-6,9-13,21H2,1-2H3,(H,23,24)(H,25,26);1H3,(H,3,4) |
| InChIKey | AIEAXGFKTQKQFX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|