C16H23N3O5 — CID 87967084
4-[5-[1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4,3-trioxazolidin-5-yl]butanoic acid (PubChem CID 87967084) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[5-[1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4,3-trioxazolidin-5-yl]butanoic acid.
| Compound Name | 4-[5-[1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4,3-trioxazolidin-5-yl]butanoic acid |
|---|---|
| PubChem CID | 87967084 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-[5-[1-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-1,2,4,3-trioxazolidin-5-yl]butanoic acid |
| SMILES | CCC(c1ccc2c(n1)NCCC2)C1(CCCC(=O)O)ONOO1 |
| InChI | InChI=1S/C16H23N3O5/c1-2-12(13-8-7-11-5-4-10-17-15(11)18-13)16(22-19-24-23-16)9-3-6-14(20)21/h7-8,12,19H,2-6,9-10H2,1H3,(H,17,18)(H,20,21) |
| InChIKey | DXCMWGHGAFSGLA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|