C13H21N3 — CID 142054793
N-pentan-3-yl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-amine (PubChem CID 142054793) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-pentan-3-yl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-amine.
| Compound Name | N-pentan-3-yl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 142054793 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-pentan-3-yl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-amine |
| SMILES | CCC(CC)Nc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C13H21N3/c1-3-11(4-2)15-12-8-7-10-6-5-9-14-13(10)16-12/h7-8,11H,3-6,9H2,1-2H3,(H2,14,15,16) |
| InChIKey | ILVZVZLRLYMCNM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |