C20H21N5O — CID 159949050
5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde;3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)prop-2-enenitrile (PubChem CID 159949050) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde;3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)prop-2-enenitrile.
| Compound Name | 5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde;3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 159949050 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5,6,7,8-tetrahydro-1,8-naphthyridine-2-carbaldehyde;3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)prop-2-enenitrile |
| SMILES | N#CC=Cc1ccc2c(n1)NCCC2.O=Cc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C11H11N3.C9H10N2O/c12-7-1-4-10-6-5-9-3-2-8-13-11(9)14-10;12-6-8-4-3-7-2-1-5-10-9(7)11-8/h1,4-6H,2-3,8H2,(H,13,14);3-4,6H,1-2,5H2,(H,10,11) |
| InChIKey | OBWDTFKIHNURQM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|