C21H32N4O5 — CID 146660534
2-(3-methoxypropanoylamino)-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid (PubChem CID 146660534) has the molecular formula C21H32N4O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-(3-methoxypropanoylamino)-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | 2-(3-methoxypropanoylamino)-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 146660534 |
| Molecular Formula | C21H32N4O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-(3-methoxypropanoylamino)-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
| SMILES | COCCC(=O)NC(CCNC(=O)CCCCc1ccc2c(n1)NCCC2)C(=O)O |
| InChI | InChI=1S/C21H32N4O5/c1-30-14-11-19(27)25-17(21(28)29)10-13-22-18(26)7-3-2-6-16-9-8-15-5-4-12-23-20(15)24-16/h8-9,17H,2-7,10-14H2,1H3,(H,22,26)(H,23,24)(H,25,27)(H,28,29) |
| InChIKey | IWULDKFRWHMHLF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|