C26H34N4O4 — CID 146661178
2-[[2-(4-methylphenyl)acetyl]amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid (PubChem CID 146661178) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[[2-(4-methylphenyl)acetyl]amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | 2-[[2-(4-methylphenyl)acetyl]amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 146661178 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-[[2-(4-methylphenyl)acetyl]amino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
| SMILES | Cc1ccc(CC(=O)NC(CCNC(=O)CCCCc2ccc3c(n2)NCCC3)C(=O)O)cc1 |
| InChI | InChI=1S/C26H34N4O4/c1-18-8-10-19(11-9-18)17-24(32)30-22(26(33)34)14-16-27-23(31)7-3-2-6-21-13-12-20-5-4-15-28-25(20)29-21/h8-13,22H,2-7,14-17H2,1H3,(H,27,31)(H,28,29)(H,30,32)(H,33,34) |
| InChIKey | YSSHEHPAKBEWOO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|