C31H46N6O7S — CID 170138233
2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid (PubChem CID 170138233) has the molecular formula C31H46N6O7S and a molecular weight of 646.81 g/mol. Its IUPAC name is 2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid.
| Compound Name | 2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
|---|---|
| PubChem CID | 170138233 |
| Molecular Formula | C31H46N6O7S |
| Molecular Weight | 646.81 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoic acid |
| SMILES | CNCCNC(=O)CCCOc1cc(C)c(S(=O)(=O)NC(CNC(=O)CCCCc2ccc3c(n2)NCCC3)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C31H46N6O7S/c1-21-18-25(44-17-7-11-27(38)33-16-15-32-3)19-22(2)29(21)45(42,43)37-26(31(40)41)20-35-28(39)10-5-4-9-24-13-12-23-8-6-14-34-30(23)36-24/h12-13,18-19,26,32,37H,4-11,14-17,20H2,1-3H3,(H,33,38)(H,34,36)(H,35,39)(H,40,41) |
| InChIKey | OJEJGPPGAUEAMZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 187.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.81 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|