C32H48N6O7S — CID 145159648
methyl 2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate (PubChem CID 145159648) has the molecular formula C32H48N6O7S and a molecular weight of 660.84 g/mol. Its IUPAC name is methyl 2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate.
| Compound Name | methyl 2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 145159648 |
| Molecular Formula | C32H48N6O7S |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | methyl 2-[[2,6-dimethyl-4-[4-[2-(methylamino)ethylamino]-4-oxobutoxy]phenyl]sulfonylamino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
| SMILES | CNCCNC(=O)CCCOc1cc(C)c(S(=O)(=O)NC(CNC(=O)CCCCc2ccc3c(n2)NCCC3)C(=O)OC)c(C)c1 |
| InChI | InChI=1S/C32H48N6O7S/c1-22-19-26(45-18-8-12-28(39)34-17-16-33-3)20-23(2)30(22)46(42,43)38-27(32(41)44-4)21-36-29(40)11-6-5-10-25-14-13-24-9-7-15-35-31(24)37-25/h13-14,19-20,27,33,38H,5-12,15-18,21H2,1-4H3,(H,34,39)(H,35,37)(H,36,40) |
| InChIKey | QNLZYKNYLJARAS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 176.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|