C28H37N5O6S — CID 162436088
methyl (2S)-2-[[1-(3-methylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate (PubChem CID 162436088) has the molecular formula C28H37N5O6S and a molecular weight of 571.70 g/mol. Its IUPAC name is methyl (2S)-2-[[1-(3-methylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate.
| Compound Name | methyl (2S)-2-[[1-(3-methylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 162436088 |
| Molecular Formula | C28H37N5O6S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | methyl (2S)-2-[[1-(3-methylphenyl)sulfonylazetidine-3-carbonyl]amino]-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]propanoate |
| SMILES | COC(=O)[C@H](CNC(=O)CCCCc1ccc2c(n1)NCCC2)NC(=O)C1CN(S(=O)(=O)c2cccc(C)c2)C1 |
| InChI | InChI=1S/C28H37N5O6S/c1-19-7-5-10-23(15-19)40(37,38)33-17-21(18-33)27(35)32-24(28(36)39-2)16-30-25(34)11-4-3-9-22-13-12-20-8-6-14-29-26(20)31-22/h5,7,10,12-13,15,21,24H,3-4,6,8-9,11,14,16-18H2,1-2H3,(H,29,31)(H,30,34)(H,32,35)/t24-/m0/s1 |
| InChIKey | ATJGXHCRHBWNPH-DEOSSOPVSA-N |
| XLogP | 1.56 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|