C30H42N4O5S2 — CID 150161920
methyl (2S)-2-[[(4S)-3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate (PubChem CID 150161920) has the molecular formula C30H42N4O5S2 and a molecular weight of 602.82 g/mol. Its IUPAC name is methyl (2S)-2-[[(4S)-3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate.
| Compound Name | methyl (2S)-2-[[(4S)-3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
|---|---|
| PubChem CID | 150161920 |
| Molecular Formula | C30H42N4O5S2 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | methyl (2S)-2-[[(4S)-3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
| SMILES | COC(=O)[C@H](CCCCCCCc1ccc2c(n1)NCCC2)NC(=O)[C@@H]1N(S(=O)(=O)c2ccccc2)CSC1(C)C |
| InChI | InChI=1S/C30H42N4O5S2/c1-30(2)26(34(21-40-30)41(37,38)24-15-9-7-10-16-24)28(35)33-25(29(36)39-3)17-11-6-4-5-8-14-23-19-18-22-13-12-20-31-27(22)32-23/h7,9-10,15-16,18-19,25-26H,4-6,8,11-14,17,20-21H2,1-3H3,(H,31,32)(H,33,35)/t25-,26-/m0/s1 |
| InChIKey | FHPVUEHBTIDYIT-UIOOFZCWSA-N |
| XLogP | 4.52 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|