C31H41N3O3 — CID 150127273
methyl (2S)-2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate (PubChem CID 150127273) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is methyl (2S)-2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate.
| Compound Name | methyl (2S)-2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
|---|---|
| PubChem CID | 150127273 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | methyl (2S)-2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
| SMILES | COC(=O)[C@H](CCCCCCCc1ccc2c(n1)NCCC2)NC(=O)C1=C(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C31H41N3O3/c1-37-31(36)28(34-30(35)27-18-11-10-17-26(27)23-13-6-5-7-14-23)19-9-4-2-3-8-16-25-21-20-24-15-12-22-32-29(24)33-25/h5-7,13-14,20-21,28H,2-4,8-12,15-19,22H2,1H3,(H,32,33)(H,34,35)/t28-/m0/s1 |
| InChIKey | FAMKGTRWKIDUBR-NDEPHWFRSA-N |
| XLogP | 6.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|