C25H37N3O4 — CID 151650152
methyl (2S)-2-(7-oxabicyclo[2.2.1]heptane-2-carbonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate (PubChem CID 151650152) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is methyl (2S)-2-(7-oxabicyclo[2.2.1]heptane-2-carbonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate.
| Compound Name | methyl (2S)-2-(7-oxabicyclo[2.2.1]heptane-2-carbonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
|---|---|
| PubChem CID | 151650152 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | methyl (2S)-2-(7-oxabicyclo[2.2.1]heptane-2-carbonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
| SMILES | COC(=O)[C@H](CCCCCCCc1ccc2c(n1)NCCC2)NC(=O)C1CC2CCC1O2 |
| InChI | InChI=1S/C25H37N3O4/c1-31-25(30)21(28-24(29)20-16-19-13-14-22(20)32-19)10-6-4-2-3-5-9-18-12-11-17-8-7-15-26-23(17)27-18/h11-12,19-22H,2-10,13-16H2,1H3,(H,26,27)(H,28,29)/t19?,20?,21-,22?/m0/s1 |
| InChIKey | QUIRBRLLUPUTKD-GMONCZTGSA-N |
| XLogP | 3.55 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|