C26H42N4O3 — CID 150655730
methyl (2S)-2-[[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate (PubChem CID 150655730) has the molecular formula C26H42N4O3 and a molecular weight of 458.65 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate.
| Compound Name | methyl (2S)-2-[[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
|---|---|
| PubChem CID | 150655730 |
| Molecular Formula | C26H42N4O3 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | methyl (2S)-2-[[(2R,6S)-2,6-dimethylpiperidine-1-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoate |
| SMILES | COC(=O)[C@H](CCCCCCCc1ccc2c(n1)NCCC2)NC(=O)N1[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C26H42N4O3/c1-19-11-9-12-20(2)30(19)26(32)29-23(25(31)33-3)15-8-6-4-5-7-14-22-17-16-21-13-10-18-27-24(21)28-22/h16-17,19-20,23H,4-15,18H2,1-3H3,(H,27,28)(H,29,32)/t19-,20+,23-/m0/s1 |
| InChIKey | JCUULMFGPQZUMJ-MZKRTTBSSA-N |
| XLogP | 4.84 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|