C27H42N4O5 — CID 146483547
(2S)-2-[[(2S,3S)-1-(3-methoxypropanoyl)-3-methylpyrrolidine-2-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 146483547) has the molecular formula C27H42N4O5 and a molecular weight of 502.66 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-1-(3-methoxypropanoyl)-3-methylpyrrolidine-2-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-1-(3-methoxypropanoyl)-3-methylpyrrolidine-2-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 146483547 |
| Molecular Formula | C27H42N4O5 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | (2S)-2-[[(2S,3S)-1-(3-methoxypropanoyl)-3-methylpyrrolidine-2-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | COCCC(=O)N1CC[C@H](C)[C@H]1C(=O)N[C@@H](CCCCCCCc1ccc2c(n1)NCCC2)C(=O)O |
| InChI | InChI=1S/C27H42N4O5/c1-19-14-17-31(23(32)15-18-36-2)24(19)26(33)30-22(27(34)35)11-7-5-3-4-6-10-21-13-12-20-9-8-16-28-25(20)29-21/h12-13,19,22,24H,3-11,14-18H2,1-2H3,(H,28,29)(H,30,33)(H,34,35)/t19-,22-,24-/m0/s1 |
| InChIKey | QJVYDNANYCGHDE-APTRMMRNSA-N |
| XLogP | 3.17 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|