C30H39N3O3 — CID 146483404
2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 146483404) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is 2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 146483404 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 2-[(2-phenylcyclohexene-1-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(NC(CCCCCCCc1ccc2c(n1)NCCC2)C(=O)O)C1=C(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C30H39N3O3/c34-29(26-17-10-9-16-25(26)22-12-5-4-6-13-22)33-27(30(35)36)18-8-3-1-2-7-15-24-20-19-23-14-11-21-31-28(23)32-24/h4-6,12-13,19-20,27H,1-3,7-11,14-18,21H2,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | NTURDCDBUDMKIF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|