C26H31N4O4+ — CID 171833006
2-[(1-phenylazet-1-ium-2-carbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 171833006) has the molecular formula C26H31N4O4+ and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[(1-phenylazet-1-ium-2-carbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | 2-[(1-phenylazet-1-ium-2-carbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 171833006 |
| Molecular Formula | C26H31N4O4+ |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 2-[(1-phenylazet-1-ium-2-carbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | O=C(NC(CCOCCCCc1ccc2c(n1)NCCC2)C(=O)O)C1=CC=[N+]1c1ccccc1 |
| InChI | InChI=1S/C26H30N4O4/c31-25(23-13-16-30(23)21-9-2-1-3-10-21)29-22(26(32)33)14-18-34-17-5-4-8-20-12-11-19-7-6-15-27-24(19)28-20/h1-3,9-13,16,22H,4-8,14-15,17-18H2,(H2-,27,28,29,31,32,33)/p+1 |
| InChIKey | ZOOUKOGBMJZOFV-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|