C23H27ClFN3O4 — CID 146462785
2-[(2-chloro-3-fluorobenzoyl)amino]-5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]pentanoic acid (PubChem CID 146462785) has the molecular formula C23H27ClFN3O4 and a molecular weight of 463.94 g/mol. Its IUPAC name is 2-[(2-chloro-3-fluorobenzoyl)amino]-5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]pentanoic acid.
| Compound Name | 2-[(2-chloro-3-fluorobenzoyl)amino]-5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]pentanoic acid |
|---|---|
| PubChem CID | 146462785 |
| Molecular Formula | C23H27ClFN3O4 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[(2-chloro-3-fluorobenzoyl)amino]-5-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]pentanoic acid |
| SMILES | O=C(NC(CCCOCCCc1ccc2c(n1)NCCC2)C(=O)O)c1cccc(F)c1Cl |
| InChI | InChI=1S/C23H27ClFN3O4/c24-20-17(7-1-8-18(20)25)22(29)28-19(23(30)31)9-4-14-32-13-3-6-16-11-10-15-5-2-12-26-21(15)27-16/h1,7-8,10-11,19H,2-6,9,12-14H2,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | SLRFNAJLBLJOQR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|