C22H26ClFN4O5 — CID 146462292
2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 146462292) has the molecular formula C22H26ClFN4O5 and a molecular weight of 480.92 g/mol. Its IUPAC name is 2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | 2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 146462292 |
| Molecular Formula | C22H26ClFN4O5 |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | O=C(NC(CCOC[C@@H](O)CCc1ccc2c(n1)NCCC2)C(=O)O)c1c(F)cncc1Cl |
| InChI | InChI=1S/C22H26ClFN4O5/c23-16-10-25-11-17(24)19(16)21(30)28-18(22(31)32)7-9-33-12-15(29)6-5-14-4-3-13-2-1-8-26-20(13)27-14/h3-4,10-11,15,18,29H,1-2,5-9,12H2,(H,26,27)(H,28,30)(H,31,32)/t15-,18?/m0/s1 |
| InChIKey | QSXIDMFPMPCZTD-BUSXIPJBSA-N |
| XLogP | 2.21 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|